C35H46N2O8S — CID 175628013
methyl (2R,6S)-5-acetamido-6-[2-acetyloxy-3-[[3-[(2E,4Z)-hexa-2,4-dien-3-yl]oxybenzoyl]amino]propyl]-2-[(3E)-6-methylhepta-1,3,5-trien-3-yl]sulfanyloxane-2-carboxylate (PubChem CID 175628013) has the molecular formula C35H46N2O8S and a molecular weight of 654.83 g/mol. Its IUPAC name is methyl (2R,6S)-5-acetamido-6-[2-acetyloxy-3-[[3-[(2E,4Z)-hexa-2,4-dien-3-yl]oxybenzoyl]amino]propyl]-2-[(3E)-6-methylhepta-1,3,5-trien-3-yl]sulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,6S)-5-acetamido-6-[2-acetyloxy-3-[[3-[(2E,4Z)-hexa-2,4-dien-3-yl]oxybenzoyl]amino]propyl]-2-[(3E)-6-methylhepta-1,3,5-trien-3-yl]sulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 175628013 |
| Molecular Formula | C35H46N2O8S |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | methyl (2R,6S)-5-acetamido-6-[2-acetyloxy-3-[[3-[(2E,4Z)-hexa-2,4-dien-3-yl]oxybenzoyl]amino]propyl]-2-[(3E)-6-methylhepta-1,3,5-trien-3-yl]sulfanyloxane-2-carboxylate |
| SMILES | C=C/C(=C\C=C(C)C)S[C@@]1(C(=O)OC)CCC(NC(C)=O)[C@H](CC(CNC(=O)c2cccc(OC(/C=C\C)=C/C)c2)OC(C)=O)O1 |
| InChI | InChI=1S/C35H46N2O8S/c1-9-13-27(10-2)44-28-15-12-14-26(20-28)33(40)36-22-29(43-25(7)39)21-32-31(37-24(6)38)18-19-35(45-32,34(41)42-8)46-30(11-3)17-16-23(4)5/h9-17,20,29,31-32H,3,18-19,21-22H2,1-2,4-8H3,(H,36,40)(H,37,38)/b13-9-,27-10+,30-17+/t29?,31?,32-,35+/m0/s1 |
| InChIKey | IEJDXNOPAXWOKD-FUEOVXBVSA-N |
| XLogP | 5.92 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|