C28H37NO10 — CID 170616003
methyl (6R)-6-[(1S)-1,2-diacetyloxy-3-[(4-acetyloxy-3,5-dimethylbenzoyl)amino]propyl]-2-prop-2-enyloxane-2-carboxylate (PubChem CID 170616003) has the molecular formula C28H37NO10 and a molecular weight of 547.60 g/mol. Its IUPAC name is methyl (6R)-6-[(1S)-1,2-diacetyloxy-3-[(4-acetyloxy-3,5-dimethylbenzoyl)amino]propyl]-2-prop-2-enyloxane-2-carboxylate.
| Compound Name | methyl (6R)-6-[(1S)-1,2-diacetyloxy-3-[(4-acetyloxy-3,5-dimethylbenzoyl)amino]propyl]-2-prop-2-enyloxane-2-carboxylate |
|---|---|
| PubChem CID | 170616003 |
| Molecular Formula | C28H37NO10 |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | methyl (6R)-6-[(1S)-1,2-diacetyloxy-3-[(4-acetyloxy-3,5-dimethylbenzoyl)amino]propyl]-2-prop-2-enyloxane-2-carboxylate |
| SMILES | C=CCC1(C(=O)OC)CCC[C@H]([C@H](OC(C)=O)C(CNC(=O)c2cc(C)c(OC(C)=O)c(C)c2)OC(C)=O)O1 |
| InChI | InChI=1S/C28H37NO10/c1-8-11-28(27(34)35-7)12-9-10-22(39-28)25(38-20(6)32)23(36-18(4)30)15-29-26(33)21-13-16(2)24(17(3)14-21)37-19(5)31/h8,13-14,22-23,25H,1,9-12,15H2,2-7H3,(H,29,33)/t22-,23?,25+,28?/m1/s1 |
| InChIKey | KQQVXBOULODRGB-RIKXPRKDSA-N |
| XLogP | 2.88 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|