C19H15ClF5N5O2 — CID 175629869
(Z,4Z)-2-chloro-3-[4-[4,5-difluoro-2-(trifluoromethyl)phenoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-4-(methylhydrazinylidene)but-2-enal (PubChem CID 175629869) has the molecular formula C19H15ClF5N5O2 and a molecular weight of 475.81 g/mol. Its IUPAC name is (Z,4Z)-2-chloro-3-[4-[4,5-difluoro-2-(trifluoromethyl)phenoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-4-(methylhydrazinylidene)but-2-enal.
| Compound Name | (Z,4Z)-2-chloro-3-[4-[4,5-difluoro-2-(trifluoromethyl)phenoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-4-(methylhydrazinylidene)but-2-enal |
|---|---|
| PubChem CID | 175629869 |
| Molecular Formula | C19H15ClF5N5O2 |
| Molecular Weight | 475.81 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | (Z,4Z)-2-chloro-3-[4-[4,5-difluoro-2-(trifluoromethyl)phenoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-4-(methylhydrazinylidene)but-2-enal |
| SMILES | CN/N=C\C(=C(\Cl)C=O)N1CCc2c(ncnc2Oc2cc(F)c(F)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C19H15ClF5N5O2/c1-26-29-6-16(12(20)8-31)30-3-2-10-15(7-30)27-9-28-18(10)32-17-5-14(22)13(21)4-11(17)19(23,24)25/h4-6,8-9,26H,2-3,7H2,1H3/b16-12-,29-6- |
| InChIKey | VVBTWBVIRJAZFD-PDJQVRCKSA-N |
| XLogP | 3.78 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.81 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|