C29H27N7O3 — CID 175632299
4-[1-[3-[4-(benzotriazol-1-yl)-2-methyl-6-nitroanilino]piperidin-1-yl]ethenyl]-1H-quinolin-2-one (PubChem CID 175632299) has the molecular formula C29H27N7O3 and a molecular weight of 521.58 g/mol. Its IUPAC name is 4-[1-[3-[4-(benzotriazol-1-yl)-2-methyl-6-nitroanilino]piperidin-1-yl]ethenyl]-1H-quinolin-2-one.
| Compound Name | 4-[1-[3-[4-(benzotriazol-1-yl)-2-methyl-6-nitroanilino]piperidin-1-yl]ethenyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 175632299 |
| Molecular Formula | C29H27N7O3 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 4-[1-[3-[4-(benzotriazol-1-yl)-2-methyl-6-nitroanilino]piperidin-1-yl]ethenyl]-1H-quinolin-2-one |
| SMILES | C=C(c1cc(=O)[nH]c2ccccc12)N1CCCC(Nc2c(C)cc(-n3nnc4ccccc43)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C29H27N7O3/c1-18-14-21(35-26-12-6-5-11-25(26)32-33-35)15-27(36(38)39)29(18)30-20-8-7-13-34(17-20)19(2)23-16-28(37)31-24-10-4-3-9-22(23)24/h3-6,9-12,14-16,20,30H,2,7-8,13,17H2,1H3,(H,31,37) |
| InChIKey | DNBNBEDHBIIJNO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|