C33H39N9O5 — CID 175636064
[4-[4-(benzotriazol-1-yl)-2-[4-(2-methoxyethyl)piperazine-1-carbonyl]-6-nitroanilino]-3,3-dimethylpyrrolidin-1-yl]-(5-methyl-3-pyridinyl)methanone (PubChem CID 175636064) has the molecular formula C33H39N9O5 and a molecular weight of 641.73 g/mol. Its IUPAC name is [4-[4-(benzotriazol-1-yl)-2-[4-(2-methoxyethyl)piperazine-1-carbonyl]-6-nitroanilino]-3,3-dimethylpyrrolidin-1-yl]-(5-methyl-3-pyridinyl)methanone.
| Compound Name | [4-[4-(benzotriazol-1-yl)-2-[4-(2-methoxyethyl)piperazine-1-carbonyl]-6-nitroanilino]-3,3-dimethylpyrrolidin-1-yl]-(5-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 175636064 |
| Molecular Formula | C33H39N9O5 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | [4-[4-(benzotriazol-1-yl)-2-[4-(2-methoxyethyl)piperazine-1-carbonyl]-6-nitroanilino]-3,3-dimethylpyrrolidin-1-yl]-(5-methyl-3-pyridinyl)methanone |
| SMILES | COCCN1CCN(C(=O)c2cc(-n3nnc4ccccc43)cc([N+](=O)[O-])c2NC2CN(C(=O)c3cncc(C)c3)CC2(C)C)CC1 |
| InChI | InChI=1S/C33H39N9O5/c1-22-15-23(19-34-18-22)31(43)40-20-29(33(2,3)21-40)35-30-25(32(44)39-11-9-38(10-12-39)13-14-47-4)16-24(17-28(30)42(45)46)41-27-8-6-5-7-26(27)36-37-41/h5-8,15-19,29,35H,9-14,20-21H2,1-4H3 |
| InChIKey | BRULYIRIZTZBGZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 151.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|