C24H23BrF5N7O5 — CID 176621648
4-[5-bromo-2-[[(3S)-4,4-difluoro-1-[5-(methylamino)pyridine-3-carbonyl]pyrrolidin-3-yl]amino]-3-nitrobenzoyl]-1-(2,2,2-trifluoroethyl)piperazin-2-one (PubChem CID 176621648) has the molecular formula C24H23BrF5N7O5 and a molecular weight of 664.39 g/mol. Its IUPAC name is 4-[5-bromo-2-[[(3S)-4,4-difluoro-1-[5-(methylamino)pyridine-3-carbonyl]pyrrolidin-3-yl]amino]-3-nitrobenzoyl]-1-(2,2,2-trifluoroethyl)piperazin-2-one.
| Compound Name | 4-[5-bromo-2-[[(3S)-4,4-difluoro-1-[5-(methylamino)pyridine-3-carbonyl]pyrrolidin-3-yl]amino]-3-nitrobenzoyl]-1-(2,2,2-trifluoroethyl)piperazin-2-one |
|---|---|
| PubChem CID | 176621648 |
| Molecular Formula | C24H23BrF5N7O5 |
| Molecular Weight | 664.39 g/mol |
| Exact Mass | 663.09 |
| IUPAC Name | 4-[5-bromo-2-[[(3S)-4,4-difluoro-1-[5-(methylamino)pyridine-3-carbonyl]pyrrolidin-3-yl]amino]-3-nitrobenzoyl]-1-(2,2,2-trifluoroethyl)piperazin-2-one |
| SMILES | CNc1cncc(C(=O)N2C[C@H](Nc3c(C(=O)N4CCN(CC(F)(F)F)C(=O)C4)cc(Br)cc3[N+](=O)[O-])C(F)(F)C2)c1 |
| InChI | InChI=1S/C24H23BrF5N7O5/c1-31-15-4-13(7-32-8-15)21(39)36-9-18(23(26,27)11-36)33-20-16(5-14(25)6-17(20)37(41)42)22(40)34-2-3-35(19(38)10-34)12-24(28,29)30/h4-8,18,31,33H,2-3,9-12H2,1H3/t18-/m0/s1 |
| InChIKey | YSPCIKUBDWLREP-SFHVURJKSA-N |
| XLogP | 3.21 |
| TPSA | 141.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|