C26H31BrN6O5 — CID 175680804
[(3R)-3-[4-bromo-2-nitro-6-(1-oxa-7-azaspiro[3.5]nonane-7-carbonyl)anilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone (PubChem CID 175680804) has the molecular formula C26H31BrN6O5 and a molecular weight of 587.48 g/mol. Its IUPAC name is [(3R)-3-[4-bromo-2-nitro-6-(1-oxa-7-azaspiro[3.5]nonane-7-carbonyl)anilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone.
| Compound Name | [(3R)-3-[4-bromo-2-nitro-6-(1-oxa-7-azaspiro[3.5]nonane-7-carbonyl)anilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 175680804 |
| Molecular Formula | C26H31BrN6O5 |
| Molecular Weight | 587.48 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | [(3R)-3-[4-bromo-2-nitro-6-(1-oxa-7-azaspiro[3.5]nonane-7-carbonyl)anilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
| SMILES | CNc1cncc(C(=O)N2CCC[C@@H](Nc3c(C(=O)N4CCC5(CCO5)CC4)cc(Br)cc3[N+](=O)[O-])C2)c1 |
| InChI | InChI=1S/C26H31BrN6O5/c1-28-20-11-17(14-29-15-20)24(34)32-7-2-3-19(16-32)30-23-21(12-18(27)13-22(23)33(36)37)25(35)31-8-4-26(5-9-31)6-10-38-26/h11-15,19,28,30H,2-10,16H2,1H3/t19-/m1/s1 |
| InChIKey | XIFAWTQVNUOOBY-LJQANCHMSA-N |
| XLogP | 3.91 |
| TPSA | 129.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|