C23H22Br2F3N5O4 — CID 175680639
[5-bromo-2-[[(3R)-1-(5-bromo-2-fluoropyridine-3-carbonyl)piperidin-3-yl]amino]-3-nitrophenyl]-(4,4-difluoropiperidin-1-yl)methanone (PubChem CID 175680639) has the molecular formula C23H22Br2F3N5O4 and a molecular weight of 649.26 g/mol. Its IUPAC name is [5-bromo-2-[[(3R)-1-(5-bromo-2-fluoropyridine-3-carbonyl)piperidin-3-yl]amino]-3-nitrophenyl]-(4,4-difluoropiperidin-1-yl)methanone.
| Compound Name | [5-bromo-2-[[(3R)-1-(5-bromo-2-fluoropyridine-3-carbonyl)piperidin-3-yl]amino]-3-nitrophenyl]-(4,4-difluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 175680639 |
| Molecular Formula | C23H22Br2F3N5O4 |
| Molecular Weight | 649.26 g/mol |
| Exact Mass | 647.00 |
| IUPAC Name | [5-bromo-2-[[(3R)-1-(5-bromo-2-fluoropyridine-3-carbonyl)piperidin-3-yl]amino]-3-nitrophenyl]-(4,4-difluoropiperidin-1-yl)methanone |
| SMILES | O=C(c1cc(Br)cnc1F)N1CCC[C@@H](Nc2c(C(=O)N3CCC(F)(F)CC3)cc(Br)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C23H22Br2F3N5O4/c24-13-8-16(21(34)31-6-3-23(27,28)4-7-31)19(18(10-13)33(36)37)30-15-2-1-5-32(12-15)22(35)17-9-14(25)11-29-20(17)26/h8-11,15,30H,1-7,12H2/t15-/m1/s1 |
| InChIKey | NLUIJTLSUUEHFJ-OAHLLOKOSA-N |
| XLogP | 5.24 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.26 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|