C23H31BrF2N4O5 — CID 176621426
tert-butyl N-[(1S,2R)-2-[4-bromo-2-(4,4-difluoropiperidine-1-carbonyl)-6-nitroanilino]cyclohexyl]carbamate (PubChem CID 176621426) has the molecular formula C23H31BrF2N4O5 and a molecular weight of 561.42 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-2-[4-bromo-2-(4,4-difluoropiperidine-1-carbonyl)-6-nitroanilino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R)-2-[4-bromo-2-(4,4-difluoropiperidine-1-carbonyl)-6-nitroanilino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 176621426 |
| Molecular Formula | C23H31BrF2N4O5 |
| Molecular Weight | 561.42 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | tert-butyl N-[(1S,2R)-2-[4-bromo-2-(4,4-difluoropiperidine-1-carbonyl)-6-nitroanilino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCC1Nc1c(C(=O)N2CCC(F)(F)CC2)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H31BrF2N4O5/c1-22(2,3)35-21(32)28-17-7-5-4-6-16(17)27-19-15(12-14(24)13-18(19)30(33)34)20(31)29-10-8-23(25,26)9-11-29/h12-13,16-17,27H,4-11H2,1-3H3,(H,28,32)/t16?,17-/m0/s1 |
| InChIKey | PRWVNWWQVGCVNF-DJNXLDHESA-N |
| XLogP | 5.48 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|