C28H27BrFN5O6 — CID 176549617
N-[(1S,2R)-2-[4-bromo-2-nitro-6-(4-oxopiperidine-1-carbonyl)anilino]cyclohexyl]-6-fluoro-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 176549617) has the molecular formula C28H27BrFN5O6 and a molecular weight of 628.46 g/mol. Its IUPAC name is N-[(1S,2R)-2-[4-bromo-2-nitro-6-(4-oxopiperidine-1-carbonyl)anilino]cyclohexyl]-6-fluoro-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[(1S,2R)-2-[4-bromo-2-nitro-6-(4-oxopiperidine-1-carbonyl)anilino]cyclohexyl]-6-fluoro-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 176549617 |
| Molecular Formula | C28H27BrFN5O6 |
| Molecular Weight | 628.46 g/mol |
| Exact Mass | 627.11 |
| IUPAC Name | N-[(1S,2R)-2-[4-bromo-2-nitro-6-(4-oxopiperidine-1-carbonyl)anilino]cyclohexyl]-6-fluoro-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | O=C1CCN(C(=O)c2cc(Br)cc([N+](=O)[O-])c2N[C@@H]2CCCC[C@@H]2NC(=O)c2cc(=O)[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C28H27BrFN5O6/c29-15-11-20(28(39)34-9-7-17(36)8-10-34)26(24(12-15)35(40)41)32-22-3-1-2-4-23(22)33-27(38)19-14-25(37)31-21-6-5-16(30)13-18(19)21/h5-6,11-14,22-23,32H,1-4,7-10H2,(H,31,37)(H,33,38)/t22-,23+/m1/s1 |
| InChIKey | BLHFQVQTXXXYGT-PKTZIBPZSA-N |
| XLogP | 4.30 |
| TPSA | 154.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|