C31H35BrN6O6 — CID 175680662
4-[(3R)-3-[4-bromo-2-(4-morpholin-4-ylpiperidine-1-carbonyl)-6-nitroanilino]piperidine-1-carbonyl]-1H-quinolin-2-one (PubChem CID 175680662) has the molecular formula C31H35BrN6O6 and a molecular weight of 667.56 g/mol. Its IUPAC name is 4-[(3R)-3-[4-bromo-2-(4-morpholin-4-ylpiperidine-1-carbonyl)-6-nitroanilino]piperidine-1-carbonyl]-1H-quinolin-2-one.
| Compound Name | 4-[(3R)-3-[4-bromo-2-(4-morpholin-4-ylpiperidine-1-carbonyl)-6-nitroanilino]piperidine-1-carbonyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 175680662 |
| Molecular Formula | C31H35BrN6O6 |
| Molecular Weight | 667.56 g/mol |
| Exact Mass | 666.18 |
| IUPAC Name | 4-[(3R)-3-[4-bromo-2-(4-morpholin-4-ylpiperidine-1-carbonyl)-6-nitroanilino]piperidine-1-carbonyl]-1H-quinolin-2-one |
| SMILES | O=C(c1cc(Br)cc([N+](=O)[O-])c1N[C@@H]1CCCN(C(=O)c2cc(=O)[nH]c3ccccc23)C1)N1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C31H35BrN6O6/c32-20-16-25(31(41)36-10-7-22(8-11-36)35-12-14-44-15-13-35)29(27(17-20)38(42)43)33-21-4-3-9-37(19-21)30(40)24-18-28(39)34-26-6-2-1-5-23(24)26/h1-2,5-6,16-18,21-22,33H,3-4,7-15,19H2,(H,34,39)/t21-/m1/s1 |
| InChIKey | AFEQBWRCXUBXHT-OAQYLSRUSA-N |
| XLogP | 3.85 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|