C23H25BrClN5O4 — CID 176621423
[(3R)-3-[4-bromo-2-nitro-6-(piperidine-1-carbonyl)anilino]piperidin-1-yl]-(5-chloro-3-pyridinyl)methanone (PubChem CID 176621423) has the molecular formula C23H25BrClN5O4 and a molecular weight of 550.84 g/mol. Its IUPAC name is [(3R)-3-[4-bromo-2-nitro-6-(piperidine-1-carbonyl)anilino]piperidin-1-yl]-(5-chloro-3-pyridinyl)methanone.
| Compound Name | [(3R)-3-[4-bromo-2-nitro-6-(piperidine-1-carbonyl)anilino]piperidin-1-yl]-(5-chloro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 176621423 |
| Molecular Formula | C23H25BrClN5O4 |
| Molecular Weight | 550.84 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | [(3R)-3-[4-bromo-2-nitro-6-(piperidine-1-carbonyl)anilino]piperidin-1-yl]-(5-chloro-3-pyridinyl)methanone |
| SMILES | O=C(c1cncc(Cl)c1)N1CCC[C@@H](Nc2c(C(=O)N3CCCCC3)cc(Br)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C23H25BrClN5O4/c24-16-10-19(23(32)28-6-2-1-3-7-28)21(20(11-16)30(33)34)27-18-5-4-8-29(14-18)22(31)15-9-17(25)13-26-12-15/h9-13,18,27H,1-8,14H2/t18-/m1/s1 |
| InChIKey | STLVVQGSYQIRJX-GOSISDBHSA-N |
| XLogP | 4.75 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.84 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|