C25H28BrF3N6O5 — CID 176621396
[(3R)-3-[4-bromo-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholine-4-carbonyl]-6-nitroanilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone (PubChem CID 176621396) has the molecular formula C25H28BrF3N6O5 and a molecular weight of 629.43 g/mol. Its IUPAC name is [(3R)-3-[4-bromo-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholine-4-carbonyl]-6-nitroanilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone.
| Compound Name | [(3R)-3-[4-bromo-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholine-4-carbonyl]-6-nitroanilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 176621396 |
| Molecular Formula | C25H28BrF3N6O5 |
| Molecular Weight | 629.43 g/mol |
| Exact Mass | 628.13 |
| IUPAC Name | [(3R)-3-[4-bromo-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholine-4-carbonyl]-6-nitroanilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
| SMILES | CNc1cncc(C(=O)N2CCC[C@@H](Nc3c(C(=O)N4C[C@@H](C)O[C@H](C(F)(F)F)C4)cc(Br)cc3[N+](=O)[O-])C2)c1 |
| InChI | InChI=1S/C25H28BrF3N6O5/c1-14-11-34(13-21(40-14)25(27,28)29)24(37)19-7-16(26)8-20(35(38)39)22(19)32-17-4-3-5-33(12-17)23(36)15-6-18(30-2)10-31-9-15/h6-10,14,17,21,30,32H,3-5,11-13H2,1-2H3/t14-,17-,21+/m1/s1 |
| InChIKey | DVEKHVNOMSFRBB-ZVGUJKQYSA-N |
| XLogP | 4.30 |
| TPSA | 129.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|