C25H29BrF2N6O4 — CID 175680633
[4-[4-bromo-2-[(3R,5S)-3,5-dimethylpiperidine-1-carbonyl]-6-nitroanilino]-3,3-difluoropyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone (PubChem CID 175680633) has the molecular formula C25H29BrF2N6O4 and a molecular weight of 595.45 g/mol. Its IUPAC name is [4-[4-bromo-2-[(3R,5S)-3,5-dimethylpiperidine-1-carbonyl]-6-nitroanilino]-3,3-difluoropyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone.
| Compound Name | [4-[4-bromo-2-[(3R,5S)-3,5-dimethylpiperidine-1-carbonyl]-6-nitroanilino]-3,3-difluoropyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 175680633 |
| Molecular Formula | C25H29BrF2N6O4 |
| Molecular Weight | 595.45 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | [4-[4-bromo-2-[(3R,5S)-3,5-dimethylpiperidine-1-carbonyl]-6-nitroanilino]-3,3-difluoropyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
| SMILES | CNc1cncc(C(=O)N2CC(Nc3c(C(=O)N4C[C@H](C)C[C@H](C)C4)cc(Br)cc3[N+](=O)[O-])C(F)(F)C2)c1 |
| InChI | InChI=1S/C25H29BrF2N6O4/c1-14-4-15(2)11-32(10-14)24(36)19-6-17(26)7-20(34(37)38)22(19)31-21-12-33(13-25(21,27)28)23(35)16-5-18(29-3)9-30-8-16/h5-9,14-15,21,29,31H,4,10-13H2,1-3H3/t14-,15+,21? |
| InChIKey | KPOCIAPINONRBM-YLQYIJTPSA-N |
| XLogP | 4.48 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|