C24H26BrF3N6O5 — CID 175680805
[(3R)-3-[4-bromo-2-nitro-6-[(2S)-2-(trifluoromethyl)morpholine-4-carbonyl]anilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone (PubChem CID 175680805) has the molecular formula C24H26BrF3N6O5 and a molecular weight of 615.41 g/mol. Its IUPAC name is [(3R)-3-[4-bromo-2-nitro-6-[(2S)-2-(trifluoromethyl)morpholine-4-carbonyl]anilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone.
| Compound Name | [(3R)-3-[4-bromo-2-nitro-6-[(2S)-2-(trifluoromethyl)morpholine-4-carbonyl]anilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 175680805 |
| Molecular Formula | C24H26BrF3N6O5 |
| Molecular Weight | 615.41 g/mol |
| Exact Mass | 614.11 |
| IUPAC Name | [(3R)-3-[4-bromo-2-nitro-6-[(2S)-2-(trifluoromethyl)morpholine-4-carbonyl]anilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
| SMILES | CNc1cncc(C(=O)N2CCC[C@@H](Nc3c(C(=O)N4CCO[C@H](C(F)(F)F)C4)cc(Br)cc3[N+](=O)[O-])C2)c1 |
| InChI | InChI=1S/C24H26BrF3N6O5/c1-29-17-7-14(10-30-11-17)22(35)32-4-2-3-16(12-32)31-21-18(8-15(25)9-19(21)34(37)38)23(36)33-5-6-39-20(13-33)24(26,27)28/h7-11,16,20,29,31H,2-6,12-13H2,1H3/t16-,20+/m1/s1 |
| InChIKey | PLUXDEJGCNYJIZ-UZLBHIALSA-N |
| XLogP | 3.91 |
| TPSA | 129.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|