C24H28BrFN6O3 — CID 175854597
[5-bromo-2-[[(3R)-1-[[5-(methylamino)-3-pyridinyl]methyl]piperidin-3-yl]amino]-3-nitrophenyl]-(4-fluoro-3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 175854597) has the molecular formula C24H28BrFN6O3 and a molecular weight of 547.43 g/mol. Its IUPAC name is [5-bromo-2-[[(3R)-1-[[5-(methylamino)-3-pyridinyl]methyl]piperidin-3-yl]amino]-3-nitrophenyl]-(4-fluoro-3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | [5-bromo-2-[[(3R)-1-[[5-(methylamino)-3-pyridinyl]methyl]piperidin-3-yl]amino]-3-nitrophenyl]-(4-fluoro-3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 175854597 |
| Molecular Formula | C24H28BrFN6O3 |
| Molecular Weight | 547.43 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | [5-bromo-2-[[(3R)-1-[[5-(methylamino)-3-pyridinyl]methyl]piperidin-3-yl]amino]-3-nitrophenyl]-(4-fluoro-3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | CNc1cncc(CN2CCC[C@@H](Nc3c(C(=O)N4CC=C(F)CC4)cc(Br)cc3[N+](=O)[O-])C2)c1 |
| InChI | InChI=1S/C24H28BrFN6O3/c1-27-20-9-16(12-28-13-20)14-30-6-2-3-19(15-30)29-23-21(10-17(25)11-22(23)32(34)35)24(33)31-7-4-18(26)5-8-31/h4,9-13,19,27,29H,2-3,5-8,14-15H2,1H3/t19-/m1/s1 |
| InChIKey | ARRPRNJDBHRSGR-LJQANCHMSA-N |
| XLogP | 4.57 |
| TPSA | 103.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|