C23H25BrF4N6O4 — CID 175854585
[5-bromo-2-[[(3R)-1-[[5-(methylamino)-3-pyridinyl]methyl]piperidin-3-yl]amino]-3-nitrophenyl]-(2,2,6,6-tetrafluoromorpholin-4-yl)methanone (PubChem CID 175854585) has the molecular formula C23H25BrF4N6O4 and a molecular weight of 605.39 g/mol. Its IUPAC name is [5-bromo-2-[[(3R)-1-[[5-(methylamino)-3-pyridinyl]methyl]piperidin-3-yl]amino]-3-nitrophenyl]-(2,2,6,6-tetrafluoromorpholin-4-yl)methanone.
| Compound Name | [5-bromo-2-[[(3R)-1-[[5-(methylamino)-3-pyridinyl]methyl]piperidin-3-yl]amino]-3-nitrophenyl]-(2,2,6,6-tetrafluoromorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 175854585 |
| Molecular Formula | C23H25BrF4N6O4 |
| Molecular Weight | 605.39 g/mol |
| Exact Mass | 604.11 |
| IUPAC Name | [5-bromo-2-[[(3R)-1-[[5-(methylamino)-3-pyridinyl]methyl]piperidin-3-yl]amino]-3-nitrophenyl]-(2,2,6,6-tetrafluoromorpholin-4-yl)methanone |
| SMILES | CNc1cncc(CN2CCC[C@@H](Nc3c(C(=O)N4CC(F)(F)OC(F)(F)C4)cc(Br)cc3[N+](=O)[O-])C2)c1 |
| InChI | InChI=1S/C23H25BrF4N6O4/c1-29-17-5-14(8-30-9-17)10-32-4-2-3-16(11-32)31-20-18(6-15(24)7-19(20)34(36)37)21(35)33-12-22(25,26)38-23(27,28)13-33/h5-9,16,29,31H,2-4,10-13H2,1H3/t16-/m1/s1 |
| InChIKey | RRLMLDVENZHRSF-MRXNPFEDSA-N |
| XLogP | 4.53 |
| TPSA | 112.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|