C27H32BrF2N7O5 — CID 175680853
[(3R)-3-[4-bromo-2-(2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carbonyl)-6-nitroanilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone (PubChem CID 175680853) has the molecular formula C27H32BrF2N7O5 and a molecular weight of 652.50 g/mol. Its IUPAC name is [(3R)-3-[4-bromo-2-(2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carbonyl)-6-nitroanilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone.
| Compound Name | [(3R)-3-[4-bromo-2-(2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carbonyl)-6-nitroanilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 175680853 |
| Molecular Formula | C27H32BrF2N7O5 |
| Molecular Weight | 652.50 g/mol |
| Exact Mass | 651.16 |
| IUPAC Name | [(3R)-3-[4-bromo-2-(2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecane-9-carbonyl)-6-nitroanilino]piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
| SMILES | CNc1cncc(C(=O)N2CCC[C@@H](Nc3c(C(=O)N4CCC5(CC4)CNCC(F)(F)O5)cc(Br)cc3[N+](=O)[O-])C2)c1 |
| InChI | InChI=1S/C27H32BrF2N7O5/c1-31-20-9-17(12-32-13-20)24(38)36-6-2-3-19(14-36)34-23-21(10-18(28)11-22(23)37(40)41)25(39)35-7-4-26(5-8-35)15-33-16-27(29,30)42-26/h9-13,19,31,33-34H,2-8,14-16H2,1H3/t19-/m1/s1 |
| InChIKey | HOSHOAVRRBBEBT-LJQANCHMSA-N |
| XLogP | 3.70 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|