C26H34BrF2N5O5 — CID 175680850
[(3R)-3-[4-bromo-2-nitro-6-(1-oxa-8-azaspiro[4.5]decane-8-carbonyl)anilino]piperidin-1-yl]-[(3R)-5,5-difluoropiperidin-3-yl]methanone (PubChem CID 175680850) has the molecular formula C26H34BrF2N5O5 and a molecular weight of 614.49 g/mol. Its IUPAC name is [(3R)-3-[4-bromo-2-nitro-6-(1-oxa-8-azaspiro[4.5]decane-8-carbonyl)anilino]piperidin-1-yl]-[(3R)-5,5-difluoropiperidin-3-yl]methanone.
| Compound Name | [(3R)-3-[4-bromo-2-nitro-6-(1-oxa-8-azaspiro[4.5]decane-8-carbonyl)anilino]piperidin-1-yl]-[(3R)-5,5-difluoropiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 175680850 |
| Molecular Formula | C26H34BrF2N5O5 |
| Molecular Weight | 614.49 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | [(3R)-3-[4-bromo-2-nitro-6-(1-oxa-8-azaspiro[4.5]decane-8-carbonyl)anilino]piperidin-1-yl]-[(3R)-5,5-difluoropiperidin-3-yl]methanone |
| SMILES | O=C(c1cc(Br)cc([N+](=O)[O-])c1N[C@@H]1CCCN(C(=O)[C@H]2CNCC(F)(F)C2)C1)N1CCC2(CCCO2)CC1 |
| InChI | InChI=1S/C26H34BrF2N5O5/c27-18-11-20(24(36)32-8-5-25(6-9-32)4-2-10-39-25)22(21(12-18)34(37)38)31-19-3-1-7-33(15-19)23(35)17-13-26(28,29)16-30-14-17/h11-12,17,19,30-31H,1-10,13-16H2/t17-,19-/m1/s1 |
| InChIKey | CPYPEKDUCWSPQG-IEBWSBKVSA-N |
| XLogP | 3.79 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|