C16H19BrF2N4O3 — CID 176621597
[5-bromo-2-[(4,4-difluoropyrrolidin-3-yl)amino]-3-nitrophenyl]-piperidin-1-ylmethanone (PubChem CID 176621597) has the molecular formula C16H19BrF2N4O3 and a molecular weight of 433.25 g/mol. Its IUPAC name is [5-bromo-2-[(4,4-difluoropyrrolidin-3-yl)amino]-3-nitrophenyl]-piperidin-1-ylmethanone.
| Compound Name | [5-bromo-2-[(4,4-difluoropyrrolidin-3-yl)amino]-3-nitrophenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 176621597 |
| Molecular Formula | C16H19BrF2N4O3 |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | [5-bromo-2-[(4,4-difluoropyrrolidin-3-yl)amino]-3-nitrophenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cc(Br)cc([N+](=O)[O-])c1NC1CNCC1(F)F)N1CCCCC1 |
| InChI | InChI=1S/C16H19BrF2N4O3/c17-10-6-11(15(24)22-4-2-1-3-5-22)14(12(7-10)23(25)26)21-13-8-20-9-16(13,18)19/h6-7,13,20-21H,1-5,8-9H2 |
| InChIKey | DUMFJLOXQCYRRA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|