C18H25BrN4O4 — CID 175632347
[5-bromo-3-nitro-2-[(1,4,4-trimethylpyrrolidin-3-yl)amino]phenyl]-morpholin-4-ylmethanone (PubChem CID 175632347) has the molecular formula C18H25BrN4O4 and a molecular weight of 441.33 g/mol. Its IUPAC name is [5-bromo-3-nitro-2-[(1,4,4-trimethylpyrrolidin-3-yl)amino]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [5-bromo-3-nitro-2-[(1,4,4-trimethylpyrrolidin-3-yl)amino]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 175632347 |
| Molecular Formula | C18H25BrN4O4 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [5-bromo-3-nitro-2-[(1,4,4-trimethylpyrrolidin-3-yl)amino]phenyl]-morpholin-4-ylmethanone |
| SMILES | CN1CC(Nc2c(C(=O)N3CCOCC3)cc(Br)cc2[N+](=O)[O-])C(C)(C)C1 |
| InChI | InChI=1S/C18H25BrN4O4/c1-18(2)11-21(3)10-15(18)20-16-13(8-12(19)9-14(16)23(25)26)17(24)22-4-6-27-7-5-22/h8-9,15,20H,4-7,10-11H2,1-3H3 |
| InChIKey | PZEXPTBJQOBOGL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|