C22H31BrN4O5 — CID 176621299
tert-butyl N-[(1S,2R)-2-[4-bromo-2-nitro-6-(pyrrolidine-1-carbonyl)anilino]cyclohexyl]carbamate (PubChem CID 176621299) has the molecular formula C22H31BrN4O5 and a molecular weight of 511.42 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-2-[4-bromo-2-nitro-6-(pyrrolidine-1-carbonyl)anilino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R)-2-[4-bromo-2-nitro-6-(pyrrolidine-1-carbonyl)anilino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 176621299 |
| Molecular Formula | C22H31BrN4O5 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | tert-butyl N-[(1S,2R)-2-[4-bromo-2-nitro-6-(pyrrolidine-1-carbonyl)anilino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC[C@H]1Nc1c(C(=O)N2CCCC2)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H31BrN4O5/c1-22(2,3)32-21(29)25-17-9-5-4-8-16(17)24-19-15(20(28)26-10-6-7-11-26)12-14(23)13-18(19)27(30)31/h12-13,16-17,24H,4-11H2,1-3H3,(H,25,29)/t16-,17+/m1/s1 |
| InChIKey | VQLTZLHGWGYWOG-SJORKVTESA-N |
| XLogP | 4.84 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|