C16H20BrClN4O4 — CID 178073780
5-bromo-2-[[(1R,2S)-2-[(2-chloroacetyl)amino]cyclohexyl]amino]-N-methyl-3-nitrobenzamide (PubChem CID 178073780) has the molecular formula C16H20BrClN4O4 and a molecular weight of 447.72 g/mol. Its IUPAC name is 5-bromo-2-[[(1R,2S)-2-[(2-chloroacetyl)amino]cyclohexyl]amino]-N-methyl-3-nitrobenzamide.
| Compound Name | 5-bromo-2-[[(1R,2S)-2-[(2-chloroacetyl)amino]cyclohexyl]amino]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 178073780 |
| Molecular Formula | C16H20BrClN4O4 |
| Molecular Weight | 447.72 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 5-bromo-2-[[(1R,2S)-2-[(2-chloroacetyl)amino]cyclohexyl]amino]-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1cc(Br)cc([N+](=O)[O-])c1NC1CCCC[C@@H]1NC(=O)CCl |
| InChI | InChI=1S/C16H20BrClN4O4/c1-19-16(24)10-6-9(17)7-13(22(25)26)15(10)21-12-5-3-2-4-11(12)20-14(23)8-18/h6-7,11-12,21H,2-5,8H2,1H3,(H,19,24)(H,20,23)/t11-,12?/m0/s1 |
| InChIKey | FHQWEMRFSNKMRP-PXYINDEMSA-N |
| XLogP | 2.80 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|