C16H18BrClN4O4 — CID 178073782
5-bromo-2-[5-(2-chloroacetyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-N-methyl-3-nitrobenzamide (PubChem CID 178073782) has the molecular formula C16H18BrClN4O4 and a molecular weight of 445.70 g/mol. Its IUPAC name is 5-bromo-2-[5-(2-chloroacetyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-N-methyl-3-nitrobenzamide.
| Compound Name | 5-bromo-2-[5-(2-chloroacetyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 178073782 |
| Molecular Formula | C16H18BrClN4O4 |
| Molecular Weight | 445.70 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 5-bromo-2-[5-(2-chloroacetyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1cc(Br)cc([N+](=O)[O-])c1N1CCC2CN(C(=O)CCl)CC21 |
| InChI | InChI=1S/C16H18BrClN4O4/c1-19-16(24)11-4-10(17)5-12(22(25)26)15(11)21-3-2-9-7-20(8-13(9)21)14(23)6-18/h4-5,9,13H,2-3,6-8H2,1H3,(H,19,24) |
| InChIKey | NQBUVPVYTPOVHM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.70 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|