C16H19BrN4O4 — CID 178073766
5-bromo-N-methyl-3-nitro-2-[(1-prop-2-enoylpiperidin-4-yl)amino]benzamide (PubChem CID 178073766) has the molecular formula C16H19BrN4O4 and a molecular weight of 411.26 g/mol. Its IUPAC name is 5-bromo-N-methyl-3-nitro-2-[(1-prop-2-enoylpiperidin-4-yl)amino]benzamide.
| Compound Name | 5-bromo-N-methyl-3-nitro-2-[(1-prop-2-enoylpiperidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 178073766 |
| Molecular Formula | C16H19BrN4O4 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 5-bromo-N-methyl-3-nitro-2-[(1-prop-2-enoylpiperidin-4-yl)amino]benzamide |
| SMILES | C=CC(=O)N1CCC(Nc2c(C(=O)NC)cc(Br)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H19BrN4O4/c1-3-14(22)20-6-4-11(5-7-20)19-15-12(16(23)18-2)8-10(17)9-13(15)21(24)25/h3,8-9,11,19H,1,4-7H2,2H3,(H,18,23) |
| InChIKey | BXHUXGANDFAQOR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|