C16H21BrN4O3 — CID 164820598
2-[[(3aS,4S,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-4-yl]amino]-5-bromo-N-methyl-3-nitrobenzamide (PubChem CID 164820598) has the molecular formula C16H21BrN4O3 and a molecular weight of 397.27 g/mol. Its IUPAC name is 2-[[(3aS,4S,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-4-yl]amino]-5-bromo-N-methyl-3-nitrobenzamide.
| Compound Name | 2-[[(3aS,4S,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-4-yl]amino]-5-bromo-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 164820598 |
| Molecular Formula | C16H21BrN4O3 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-[[(3aS,4S,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-4-yl]amino]-5-bromo-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1cc(Br)cc([N+](=O)[O-])c1N[C@H]1CCC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C16H21BrN4O3/c1-18-16(22)11-5-10(17)6-14(21(23)24)15(11)20-13-4-2-3-9-7-19-8-12(9)13/h5-6,9,12-13,19-20H,2-4,7-8H2,1H3,(H,18,22)/t9-,12+,13-/m0/s1 |
| InChIKey | PVOYQINKQRHRAR-BIMULSAOSA-N |
| XLogP | 2.52 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|