C24H22BrN5O4 — CID 164513359
N-[(1S,6R)-6-[4-bromo-2-(methylcarbamoyl)-6-nitroanilino]cyclohex-3-en-1-yl]isoquinoline-4-carboxamide (PubChem CID 164513359) has the molecular formula C24H22BrN5O4 and a molecular weight of 524.38 g/mol. Its IUPAC name is N-[(1S,6R)-6-[4-bromo-2-(methylcarbamoyl)-6-nitroanilino]cyclohex-3-en-1-yl]isoquinoline-4-carboxamide.
| Compound Name | N-[(1S,6R)-6-[4-bromo-2-(methylcarbamoyl)-6-nitroanilino]cyclohex-3-en-1-yl]isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 164513359 |
| Molecular Formula | C24H22BrN5O4 |
| Molecular Weight | 524.38 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | N-[(1S,6R)-6-[4-bromo-2-(methylcarbamoyl)-6-nitroanilino]cyclohex-3-en-1-yl]isoquinoline-4-carboxamide |
| SMILES | CNC(=O)c1cc(Br)cc([N+](=O)[O-])c1N[C@@H]1CC=CC[C@@H]1NC(=O)c1cncc2ccccc12 |
| InChI | InChI=1S/C24H22BrN5O4/c1-26-23(31)17-10-15(25)11-21(30(33)34)22(17)28-19-8-4-5-9-20(19)29-24(32)18-13-27-12-14-6-2-3-7-16(14)18/h2-7,10-13,19-20,28H,8-9H2,1H3,(H,26,31)(H,29,32)/t19-,20+/m1/s1 |
| InChIKey | SJUHNCAVFVCWIN-UXHICEINSA-N |
| XLogP | 4.19 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|