C25H26BrN3O5 — CID 165109204
5-bromo-2-[4-ethyl-6-(5-hydroxyisoquinolin-4-yl)-6-oxohexyl]-N-methyl-3-nitrobenzamide (PubChem CID 165109204) has the molecular formula C25H26BrN3O5 and a molecular weight of 528.40 g/mol. Its IUPAC name is 5-bromo-2-[4-ethyl-6-(5-hydroxyisoquinolin-4-yl)-6-oxohexyl]-N-methyl-3-nitrobenzamide.
| Compound Name | 5-bromo-2-[4-ethyl-6-(5-hydroxyisoquinolin-4-yl)-6-oxohexyl]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 165109204 |
| Molecular Formula | C25H26BrN3O5 |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 5-bromo-2-[4-ethyl-6-(5-hydroxyisoquinolin-4-yl)-6-oxohexyl]-N-methyl-3-nitrobenzamide |
| SMILES | CCC(CCCc1c(C(=O)NC)cc(Br)cc1[N+](=O)[O-])CC(=O)c1cncc2cccc(O)c12 |
| InChI | InChI=1S/C25H26BrN3O5/c1-3-15(10-23(31)20-14-28-13-16-7-5-9-22(30)24(16)20)6-4-8-18-19(25(32)27-2)11-17(26)12-21(18)29(33)34/h5,7,9,11-15,30H,3-4,6,8,10H2,1-2H3,(H,27,32) |
| InChIKey | ZQYKRKSIAHYBAA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|