C31H30BrN5O5 — CID 167160573
5-bromo-2-[(4S,5R)-4-cyclohexa-2,4-dien-1-yl-2-(7-hydroxyisoquinoline-4-carbonyl)-2,7-diazaspiro[4.4]nonan-7-yl]-N-methyl-3-nitrobenzamide (PubChem CID 167160573) has the molecular formula C31H30BrN5O5 and a molecular weight of 632.52 g/mol. Its IUPAC name is 5-bromo-2-[(4S,5R)-4-cyclohexa-2,4-dien-1-yl-2-(7-hydroxyisoquinoline-4-carbonyl)-2,7-diazaspiro[4.4]nonan-7-yl]-N-methyl-3-nitrobenzamide.
| Compound Name | 5-bromo-2-[(4S,5R)-4-cyclohexa-2,4-dien-1-yl-2-(7-hydroxyisoquinoline-4-carbonyl)-2,7-diazaspiro[4.4]nonan-7-yl]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 167160573 |
| Molecular Formula | C31H30BrN5O5 |
| Molecular Weight | 632.52 g/mol |
| Exact Mass | 631.14 |
| IUPAC Name | 5-bromo-2-[(4S,5R)-4-cyclohexa-2,4-dien-1-yl-2-(7-hydroxyisoquinoline-4-carbonyl)-2,7-diazaspiro[4.4]nonan-7-yl]-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1cc(Br)cc([N+](=O)[O-])c1N1CC[C@]2(CN(C(=O)c3cncc4cc(O)ccc34)C[C@H]2C2C=CC=CC2)C1 |
| InChI | InChI=1S/C31H30BrN5O5/c1-33-29(39)24-12-21(32)13-27(37(41)42)28(24)35-10-9-31(17-35)18-36(16-26(31)19-5-3-2-4-6-19)30(40)25-15-34-14-20-11-22(38)7-8-23(20)25/h2-5,7-8,11-15,19,26,38H,6,9-10,16-18H2,1H3,(H,33,39)/t19?,26-,31+/m0/s1 |
| InChIKey | OJNRGWRNFNXXCM-NFPCOSMSSA-N |
| XLogP | 5.07 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|