C26H27BrN6O4 — CID 175632259
[5-bromo-2-[[1-(7-methylisoquinoline-4-carbonyl)pyrrolidin-3-yl]amino]-3-nitrophenyl]-piperazin-1-ylmethanone (PubChem CID 175632259) has the molecular formula C26H27BrN6O4 and a molecular weight of 567.44 g/mol. Its IUPAC name is [5-bromo-2-[[1-(7-methylisoquinoline-4-carbonyl)pyrrolidin-3-yl]amino]-3-nitrophenyl]-piperazin-1-ylmethanone.
| Compound Name | [5-bromo-2-[[1-(7-methylisoquinoline-4-carbonyl)pyrrolidin-3-yl]amino]-3-nitrophenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 175632259 |
| Molecular Formula | C26H27BrN6O4 |
| Molecular Weight | 567.44 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | [5-bromo-2-[[1-(7-methylisoquinoline-4-carbonyl)pyrrolidin-3-yl]amino]-3-nitrophenyl]-piperazin-1-ylmethanone |
| SMILES | Cc1ccc2c(C(=O)N3CCC(Nc4c(C(=O)N5CCNCC5)cc(Br)cc4[N+](=O)[O-])C3)cncc2c1 |
| InChI | InChI=1S/C26H27BrN6O4/c1-16-2-3-20-17(10-16)13-29-14-22(20)26(35)32-7-4-19(15-32)30-24-21(11-18(27)12-23(24)33(36)37)25(34)31-8-5-28-6-9-31/h2-3,10-14,19,28,30H,4-9,15H2,1H3 |
| InChIKey | NGNSXHJPCTUPMK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|