C26H30BrN7O2 — CID 175626551
[3-amino-2-[[(3R)-1-(1-aminoisoquinoline-4-carbonyl)piperidin-3-yl]amino]-5-bromophenyl]-piperazin-1-ylmethanone (PubChem CID 175626551) has the molecular formula C26H30BrN7O2 and a molecular weight of 552.48 g/mol. Its IUPAC name is [3-amino-2-[[(3R)-1-(1-aminoisoquinoline-4-carbonyl)piperidin-3-yl]amino]-5-bromophenyl]-piperazin-1-ylmethanone.
| Compound Name | [3-amino-2-[[(3R)-1-(1-aminoisoquinoline-4-carbonyl)piperidin-3-yl]amino]-5-bromophenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 175626551 |
| Molecular Formula | C26H30BrN7O2 |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | [3-amino-2-[[(3R)-1-(1-aminoisoquinoline-4-carbonyl)piperidin-3-yl]amino]-5-bromophenyl]-piperazin-1-ylmethanone |
| SMILES | Nc1cc(Br)cc(C(=O)N2CCNCC2)c1N[C@@H]1CCCN(C(=O)c2cnc(N)c3ccccc23)C1 |
| InChI | InChI=1S/C26H30BrN7O2/c27-16-12-20(25(35)33-10-7-30-8-11-33)23(22(28)13-16)32-17-4-3-9-34(15-17)26(36)21-14-31-24(29)19-6-2-1-5-18(19)21/h1-2,5-6,12-14,17,30,32H,3-4,7-11,15,28H2,(H2,29,31)/t17-/m1/s1 |
| InChIKey | IGJKVNPPDUYKSJ-QGZVFWFLSA-N |
| XLogP | 2.92 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|