C18H27BrN4O — CID 175631376
[5-bromo-3-(methylamino)-2-[[(3R)-piperidin-3-yl]amino]phenyl]-piperidin-1-ylmethanone (PubChem CID 175631376) has the molecular formula C18H27BrN4O and a molecular weight of 395.35 g/mol. Its IUPAC name is [5-bromo-3-(methylamino)-2-[[(3R)-piperidin-3-yl]amino]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [5-bromo-3-(methylamino)-2-[[(3R)-piperidin-3-yl]amino]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 175631376 |
| Molecular Formula | C18H27BrN4O |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [5-bromo-3-(methylamino)-2-[[(3R)-piperidin-3-yl]amino]phenyl]-piperidin-1-ylmethanone |
| SMILES | CNc1cc(Br)cc(C(=O)N2CCCCC2)c1N[C@@H]1CCCNC1 |
| InChI | InChI=1S/C18H27BrN4O/c1-20-16-11-13(19)10-15(18(24)23-8-3-2-4-9-23)17(16)22-14-6-5-7-21-12-14/h10-11,14,20-22H,2-9,12H2,1H3/t14-/m1/s1 |
| InChIKey | ZCTXOEPAUFHPKV-CQSZACIVSA-N |
| XLogP | 3.28 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |