C26H30BrN7O4 — CID 176621526
[5-bromo-3-nitro-2-[[(3R)-1-(1H-pyrrolo[2,3-c]pyridine-4-carbonyl)piperidin-3-yl]amino]phenyl]-[(3R,5S)-3,5-dimethylpiperazin-1-yl]methanone (PubChem CID 176621526) has the molecular formula C26H30BrN7O4 and a molecular weight of 584.48 g/mol. Its IUPAC name is [5-bromo-3-nitro-2-[[(3R)-1-(1H-pyrrolo[2,3-c]pyridine-4-carbonyl)piperidin-3-yl]amino]phenyl]-[(3R,5S)-3,5-dimethylpiperazin-1-yl]methanone.
| Compound Name | [5-bromo-3-nitro-2-[[(3R)-1-(1H-pyrrolo[2,3-c]pyridine-4-carbonyl)piperidin-3-yl]amino]phenyl]-[(3R,5S)-3,5-dimethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 176621526 |
| Molecular Formula | C26H30BrN7O4 |
| Molecular Weight | 584.48 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | [5-bromo-3-nitro-2-[[(3R)-1-(1H-pyrrolo[2,3-c]pyridine-4-carbonyl)piperidin-3-yl]amino]phenyl]-[(3R,5S)-3,5-dimethylpiperazin-1-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2cc(Br)cc([N+](=O)[O-])c2N[C@@H]2CCCN(C(=O)c3cncc4[nH]ccc34)C2)C[C@H](C)N1 |
| InChI | InChI=1S/C26H30BrN7O4/c1-15-12-33(13-16(2)30-15)25(35)20-8-17(27)9-23(34(37)38)24(20)31-18-4-3-7-32(14-18)26(36)21-10-28-11-22-19(21)5-6-29-22/h5-6,8-11,15-16,18,29-31H,3-4,7,12-14H2,1-2H3/t15-,16+,18-/m1/s1 |
| InChIKey | UOPMWRCMKXZFQV-SOLBZPMBSA-N |
| XLogP | 3.77 |
| TPSA | 136.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|