C25H34BrClN6O3 — CID 175636421
1-[(3R)-3-[2-amino-4-bromo-6-[(2S)-2-(chloromethyl)morpholine-4-carbonyl]anilino]piperidin-1-yl]-2-[[(E)-2-(methylamino)prop-1-enyl]iminomethyl]prop-2-en-1-one (PubChem CID 175636421) has the molecular formula C25H34BrClN6O3 and a molecular weight of 581.94 g/mol. Its IUPAC name is 1-[(3R)-3-[2-amino-4-bromo-6-[(2S)-2-(chloromethyl)morpholine-4-carbonyl]anilino]piperidin-1-yl]-2-[[(E)-2-(methylamino)prop-1-enyl]iminomethyl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[2-amino-4-bromo-6-[(2S)-2-(chloromethyl)morpholine-4-carbonyl]anilino]piperidin-1-yl]-2-[[(E)-2-(methylamino)prop-1-enyl]iminomethyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175636421 |
| Molecular Formula | C25H34BrClN6O3 |
| Molecular Weight | 581.94 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 1-[(3R)-3-[2-amino-4-bromo-6-[(2S)-2-(chloromethyl)morpholine-4-carbonyl]anilino]piperidin-1-yl]-2-[[(E)-2-(methylamino)prop-1-enyl]iminomethyl]prop-2-en-1-one |
| SMILES | C=C(/C=N/C=C(\C)NC)C(=O)N1CCC[C@@H](Nc2c(N)cc(Br)cc2C(=O)N2CCO[C@H](CCl)C2)C1 |
| InChI | InChI=1S/C25H34BrClN6O3/c1-16(12-30-13-17(2)29-3)24(34)32-6-4-5-19(14-32)31-23-21(9-18(26)10-22(23)28)25(35)33-7-8-36-20(11-27)15-33/h9-10,12-13,19-20,29,31H,1,4-8,11,14-15,28H2,2-3H3/b17-13+,30-12+/t19-,20-/m1/s1 |
| InChIKey | AEHWGGXHGZWYSY-ZZWUCGQOSA-N |
| XLogP | 3.22 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.94 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|