C23H25Br2N5O5 — CID 175680765
[(4S)-4-[4-bromo-2-nitro-6-(piperidine-1-carbonyl)anilino]-3-hydroxy-3-methylpyrrolidin-1-yl]-(5-bromo-3-pyridinyl)methanone (PubChem CID 175680765) has the molecular formula C23H25Br2N5O5 and a molecular weight of 611.29 g/mol. Its IUPAC name is [(4S)-4-[4-bromo-2-nitro-6-(piperidine-1-carbonyl)anilino]-3-hydroxy-3-methylpyrrolidin-1-yl]-(5-bromo-3-pyridinyl)methanone.
| Compound Name | [(4S)-4-[4-bromo-2-nitro-6-(piperidine-1-carbonyl)anilino]-3-hydroxy-3-methylpyrrolidin-1-yl]-(5-bromo-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 175680765 |
| Molecular Formula | C23H25Br2N5O5 |
| Molecular Weight | 611.29 g/mol |
| Exact Mass | 609.02 |
| IUPAC Name | [(4S)-4-[4-bromo-2-nitro-6-(piperidine-1-carbonyl)anilino]-3-hydroxy-3-methylpyrrolidin-1-yl]-(5-bromo-3-pyridinyl)methanone |
| SMILES | CC1(O)CN(C(=O)c2cncc(Br)c2)C[C@@H]1Nc1c(C(=O)N2CCCCC2)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H25Br2N5O5/c1-23(33)13-29(21(31)14-7-16(25)11-26-10-14)12-19(23)27-20-17(8-15(24)9-18(20)30(34)35)22(32)28-5-3-2-4-6-28/h7-11,19,27,33H,2-6,12-13H2,1H3/t19-,23?/m0/s1 |
| InChIKey | VTDWYVNHJBLWNB-HSTJUUNISA-N |
| XLogP | 3.83 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|