C25H28BrN7O5 — CID 176621638
[(2S,4R)-4-[4-bromo-2-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-nitroanilino]-2-isocyanopyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone (PubChem CID 176621638) has the molecular formula C25H28BrN7O5 and a molecular weight of 586.45 g/mol. Its IUPAC name is [(2S,4R)-4-[4-bromo-2-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-nitroanilino]-2-isocyanopyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone.
| Compound Name | [(2S,4R)-4-[4-bromo-2-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-nitroanilino]-2-isocyanopyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 176621638 |
| Molecular Formula | C25H28BrN7O5 |
| Molecular Weight | 586.45 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | [(2S,4R)-4-[4-bromo-2-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-nitroanilino]-2-isocyanopyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
| SMILES | [C-]#[N+][C@H]1C[C@@H](Nc2c(C(=O)N3C[C@@H](C)O[C@@H](C)C3)cc(Br)cc2[N+](=O)[O-])CN1C(=O)c1cncc(NC)c1 |
| InChI | InChI=1S/C25H28BrN7O5/c1-14-11-31(12-15(2)38-14)25(35)20-6-17(26)7-21(33(36)37)23(20)30-19-8-22(28-4)32(13-19)24(34)16-5-18(27-3)10-29-9-16/h5-7,9-10,14-15,19,22,27,30H,8,11-13H2,1-3H3/t14-,15+,19-,22-/m1/s1 |
| InChIKey | AKFAZIVTBYCBAR-DAMNHTQYSA-N |
| XLogP | 3.62 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|