C20H21B2FN5O2P — CID 175632841
CID 175632841 (PubChem CID 175632841) has the molecular formula C20H21B2FN5O2P and a molecular weight of 435.02 g/mol.
| Compound Name | CID 175632841 |
|---|---|
| PubChem CID | 175632841 |
| Molecular Formula | C20H21B2FN5O2P |
| Molecular Weight | 435.02 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | — |
| SMILES | [B]N1CCC(n2cc3cc(NC(=O)c4cccc(C([B])(F)P)n4)c(OC)cc3n2)CC1 |
| InChI | InChI=1S/C20H21B2FN5O2P/c1-30-17-10-15-12(11-28(26-15)13-5-7-27(22)8-6-13)9-16(17)25-19(29)14-3-2-4-18(24-14)20(21,23)31/h2-4,9-11,13H,5-8,31H2,1H3,(H,25,29) |
| InChIKey | IVWIMGSYFHRXTF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.02 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|