C14H30FN3O — CID 175633265
2-(ethylaminomethyl)-4-fluoro-1-[(3R)-3-(methylamino)piperidin-1-yl]pentan-1-ol (PubChem CID 175633265) has the molecular formula C14H30FN3O and a molecular weight of 275.41 g/mol. Its IUPAC name is 2-(ethylaminomethyl)-4-fluoro-1-[(3R)-3-(methylamino)piperidin-1-yl]pentan-1-ol.
| Compound Name | 2-(ethylaminomethyl)-4-fluoro-1-[(3R)-3-(methylamino)piperidin-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 175633265 |
| Molecular Formula | C14H30FN3O |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | 2-(ethylaminomethyl)-4-fluoro-1-[(3R)-3-(methylamino)piperidin-1-yl]pentan-1-ol |
| SMILES | CCNCC(CC(C)F)C(O)N1CCC[C@@H](NC)C1 |
| InChI | InChI=1S/C14H30FN3O/c1-4-17-9-12(8-11(2)15)14(19)18-7-5-6-13(10-18)16-3/h11-14,16-17,19H,4-10H2,1-3H3/t11?,12?,13-,14?/m1/s1 |
| InChIKey | XUNBIIYKALDTIM-WCFLAILDSA-N |
| XLogP | 0.96 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |