C21H27N3O3S — CID 175634411
1-[1-methyl-4-[[2-(2-morpholin-4-ylethylsulfanyl)phenyl]methyl]pyrazol-3-yl]butane-1,3-dione (PubChem CID 175634411) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 1-[1-methyl-4-[[2-(2-morpholin-4-ylethylsulfanyl)phenyl]methyl]pyrazol-3-yl]butane-1,3-dione.
| Compound Name | 1-[1-methyl-4-[[2-(2-morpholin-4-ylethylsulfanyl)phenyl]methyl]pyrazol-3-yl]butane-1,3-dione |
|---|---|
| PubChem CID | 175634411 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 1-[1-methyl-4-[[2-(2-morpholin-4-ylethylsulfanyl)phenyl]methyl]pyrazol-3-yl]butane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1nn(C)cc1Cc1ccccc1SCCN1CCOCC1 |
| InChI | InChI=1S/C21H27N3O3S/c1-16(25)13-19(26)21-18(15-23(2)22-21)14-17-5-3-4-6-20(17)28-12-9-24-7-10-27-11-8-24/h3-6,15H,7-14H2,1-2H3 |
| InChIKey | TZNFSZNALWLPRO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|