C20H26N4O4 — CID 175634401
1-[1-methyl-4-[[2-(2-morpholin-4-ylethoxy)-3-pyridinyl]methyl]pyrazol-3-yl]butane-1,3-dione (PubChem CID 175634401) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 1-[1-methyl-4-[[2-(2-morpholin-4-ylethoxy)-3-pyridinyl]methyl]pyrazol-3-yl]butane-1,3-dione.
| Compound Name | 1-[1-methyl-4-[[2-(2-morpholin-4-ylethoxy)-3-pyridinyl]methyl]pyrazol-3-yl]butane-1,3-dione |
|---|---|
| PubChem CID | 175634401 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-[1-methyl-4-[[2-(2-morpholin-4-ylethoxy)-3-pyridinyl]methyl]pyrazol-3-yl]butane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1nn(C)cc1Cc1cccnc1OCCN1CCOCC1 |
| InChI | InChI=1S/C20H26N4O4/c1-15(25)12-18(26)19-17(14-23(2)22-19)13-16-4-3-5-21-20(16)28-11-8-24-6-9-27-10-7-24/h3-5,14H,6-13H2,1-2H3 |
| InChIKey | WSHNNAQCFPATHS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|