C18H24O4 — CID 175634493
3-[4-(5-hydroxy-2-oxohexan-3-yl)phenyl]hexane-2,5-dione (PubChem CID 175634493) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-[4-(5-hydroxy-2-oxohexan-3-yl)phenyl]hexane-2,5-dione.
| Compound Name | 3-[4-(5-hydroxy-2-oxohexan-3-yl)phenyl]hexane-2,5-dione |
|---|---|
| PubChem CID | 175634493 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 3-[4-(5-hydroxy-2-oxohexan-3-yl)phenyl]hexane-2,5-dione |
| SMILES | CC(=O)CC(C(C)=O)c1ccc(C(CC(C)O)C(C)=O)cc1 |
| InChI | InChI=1S/C18H24O4/c1-11(19)9-17(13(3)21)15-5-7-16(8-6-15)18(14(4)22)10-12(2)20/h5-8,11,17-19H,9-10H2,1-4H3 |
| InChIKey | QDRZTUHEGQQMDZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |