C13H22F2O — CID 175636548
6a-ethyl-4,4-difluoro-3-propan-2-yloxy-1,2,3,3a,5,6-hexahydropentalene (PubChem CID 175636548) has the molecular formula C13H22F2O and a molecular weight of 232.31 g/mol. Its IUPAC name is 6a-ethyl-4,4-difluoro-3-propan-2-yloxy-1,2,3,3a,5,6-hexahydropentalene.
| Compound Name | 6a-ethyl-4,4-difluoro-3-propan-2-yloxy-1,2,3,3a,5,6-hexahydropentalene |
|---|---|
| PubChem CID | 175636548 |
| Molecular Formula | C13H22F2O |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 6a-ethyl-4,4-difluoro-3-propan-2-yloxy-1,2,3,3a,5,6-hexahydropentalene |
| SMILES | CCC12CCC(OC(C)C)C1C(F)(F)CC2 |
| InChI | InChI=1S/C13H22F2O/c1-4-12-6-5-10(16-9(2)3)11(12)13(14,15)8-7-12/h9-11H,4-8H2,1-3H3 |
| InChIKey | LXYVCTKGACQTFJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |