C27H52N6O10 — CID 175636717
2-[7-(carboxymethyl)-4-[[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]hydrazinyl]methyl]-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 175636717) has the molecular formula C27H52N6O10 and a molecular weight of 620.75 g/mol. Its IUPAC name is 2-[7-(carboxymethyl)-4-[[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]hydrazinyl]methyl]-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[7-(carboxymethyl)-4-[[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]hydrazinyl]methyl]-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 175636717 |
| Molecular Formula | C27H52N6O10 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.37 |
| IUPAC Name | 2-[7-(carboxymethyl)-4-[[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]hydrazinyl]methyl]-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(=O)CCOCCOCCOCCOCCNNCN1CCN(CC(=O)O)CCN(CC=O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C27H52N6O10/c1-25(35)2-14-40-16-18-42-20-21-43-19-17-41-15-3-28-29-24-33-10-8-31(22-26(36)37)6-4-30(12-13-34)5-7-32(9-11-33)23-27(38)39/h13,28-29H,2-12,14-24H2,1H3,(H,36,37)(H,38,39) |
| InChIKey | KEVIFISCZMLFGM-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 182.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|