C19H24F3N3O2S — CID 175636855
tert-butyl-[[6-methyl-1-(oxan-2-yl)-5-(trifluoromethyl)indazol-4-yl]methylideneamino]-oxidosulfanium (PubChem CID 175636855) has the molecular formula C19H24F3N3O2S and a molecular weight of 415.48 g/mol. Its IUPAC name is tert-butyl-[[6-methyl-1-(oxan-2-yl)-5-(trifluoromethyl)indazol-4-yl]methylideneamino]-oxidosulfanium.
| Compound Name | tert-butyl-[[6-methyl-1-(oxan-2-yl)-5-(trifluoromethyl)indazol-4-yl]methylideneamino]-oxidosulfanium |
|---|---|
| PubChem CID | 175636855 |
| Molecular Formula | C19H24F3N3O2S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | tert-butyl-[[6-methyl-1-(oxan-2-yl)-5-(trifluoromethyl)indazol-4-yl]methylideneamino]-oxidosulfanium |
| SMILES | Cc1cc2c(cnn2C2CCCCO2)c(C=N[S+]([O-])C(C)(C)C)c1C(F)(F)F |
| InChI | InChI=1S/C19H24F3N3O2S/c1-12-9-15-13(10-23-25(15)16-7-5-6-8-27-16)14(17(12)19(20,21)22)11-24-28(26)18(2,3)4/h9-11,16H,5-8H2,1-4H3 |
| InChIKey | UMILUNOUTBFXEU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|