C29H57N5O13 — CID 175638073
3-[2-[2-[2-[2-[2-[bis(2,3,4,6-tetrahydroxyhexyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-N-butyltriazole-4-carboxamide (PubChem CID 175638073) has the molecular formula C29H57N5O13 and a molecular weight of 683.80 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[2-[bis(2,3,4,6-tetrahydroxyhexyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-N-butyltriazole-4-carboxamide.
| Compound Name | 3-[2-[2-[2-[2-[2-[bis(2,3,4,6-tetrahydroxyhexyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-N-butyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 175638073 |
| Molecular Formula | C29H57N5O13 |
| Molecular Weight | 683.80 g/mol |
| Exact Mass | 683.40 |
| IUPAC Name | 3-[2-[2-[2-[2-[2-[bis(2,3,4,6-tetrahydroxyhexyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-N-butyltriazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1cnnn1CCOCCOCCOCCOCCN(CC(O)C(O)C(O)CCO)CC(O)C(O)C(O)CCO |
| InChI | InChI=1S/C29H57N5O13/c1-2-3-6-30-29(43)22-19-31-32-34(22)8-12-45-14-16-47-18-17-46-15-13-44-11-7-33(20-25(39)27(41)23(37)4-9-35)21-26(40)28(42)24(38)5-10-36/h19,23-28,35-42H,2-18,20-21H2,1H3,(H,30,43) |
| InChIKey | YNIRDFTYUSMWLA-UHFFFAOYSA-N |
| XLogP | -3.89 |
| TPSA | 261.81 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.80 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|