C40H84N2O19 — CID 171850612
6-[2-[2-[2-[5-[2-[2-[2-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]pentoxy]ethoxy]ethoxy]ethyl-(2,3,4,6-tetrahydroxyhexyl)amino]hexane-1,3,4,5-tetrol (PubChem CID 171850612) has the molecular formula C40H84N2O19 and a molecular weight of 897.11 g/mol. Its IUPAC name is 6-[2-[2-[2-[5-[2-[2-[2-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]pentoxy]ethoxy]ethoxy]ethyl-(2,3,4,6-tetrahydroxyhexyl)amino]hexane-1,3,4,5-tetrol.
| Compound Name | 6-[2-[2-[2-[5-[2-[2-[2-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]pentoxy]ethoxy]ethoxy]ethyl-(2,3,4,6-tetrahydroxyhexyl)amino]hexane-1,3,4,5-tetrol |
|---|---|
| PubChem CID | 171850612 |
| Molecular Formula | C40H84N2O19 |
| Molecular Weight | 897.11 g/mol |
| Exact Mass | 896.57 |
| IUPAC Name | 6-[2-[2-[2-[5-[2-[2-[2-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]pentoxy]ethoxy]ethoxy]ethyl-(2,3,4,6-tetrahydroxyhexyl)amino]hexane-1,3,4,5-tetrol |
| SMILES | CNCCOCCOCCOCCOCCOCCOCCOCCOCCCCCOCCOCCOCCN(CC(O)C(O)C(O)CCO)CC(O)C(O)C(O)CCO |
| InChI | InChI=1S/C40H84N2O19/c1-41-7-13-53-17-21-57-24-26-59-28-30-61-32-31-60-29-27-58-25-23-56-20-16-52-12-4-2-3-11-51-15-19-55-22-18-54-14-8-42(33-37(47)39(49)35(45)5-9-43)34-38(48)40(50)36(46)6-10-44/h35-41,43-50H,2-34H2,1H3 |
| InChIKey | FRODKZVKDOAKHH-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 278.64 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.11 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|