C18H40N2O8 — CID 171850614
6-[methyl-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]amino]hexane-1,3,4,5-tetrol (PubChem CID 171850614) has the molecular formula C18H40N2O8 and a molecular weight of 412.52 g/mol. Its IUPAC name is 6-[methyl-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]amino]hexane-1,3,4,5-tetrol.
| Compound Name | 6-[methyl-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]amino]hexane-1,3,4,5-tetrol |
|---|---|
| PubChem CID | 171850614 |
| Molecular Formula | C18H40N2O8 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 6-[methyl-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]amino]hexane-1,3,4,5-tetrol |
| SMILES | CNCCOCCOCCOCCOCCN(C)CC(O)C(O)C(O)CCO |
| InChI | InChI=1S/C18H40N2O8/c1-19-4-7-25-9-11-27-13-14-28-12-10-26-8-5-20(2)15-17(23)18(24)16(22)3-6-21/h16-19,21-24H,3-15H2,1-2H3 |
| InChIKey | FBWMNYSWMNCABN-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 133.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|