C30H59BN2O15 — CID 175631387
CID 175631387 (PubChem CID 175631387) has the molecular formula C30H59BN2O15 and a molecular weight of 698.61 g/mol.
| Compound Name | CID 175631387 |
|---|---|
| PubChem CID | 175631387 |
| Molecular Formula | C30H59BN2O15 |
| Molecular Weight | 698.61 g/mol |
| Exact Mass | 698.40 |
| IUPAC Name | — |
| SMILES | [B]OC(CCO)C(O)C(O)CN(CCOCCOCCCCOCCOCCOCCOCCC(C)=O)CC(O)C(O)C(O)CCN=O |
| InChI | InChI=1S/C30H59BN2O15/c1-24(35)6-12-44-16-19-47-21-20-46-18-15-43-11-3-2-10-42-14-17-45-13-8-33(22-26(37)29(39)25(36)4-7-32-41)23-27(38)30(40)28(48-31)5-9-34/h25-30,34,36-40H,2-23H2,1H3 |
| InChIKey | VJMBHEQCCMPKJJ-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 235.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.61 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|