C23H36N4O4 — CID 175641745
4-[[3-[3-[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-2-hydroxypropoxy]phenyl]methyl]-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 175641745) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is 4-[[3-[3-[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-2-hydroxypropoxy]phenyl]methyl]-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-[[3-[3-[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-2-hydroxypropoxy]phenyl]methyl]-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 175641745 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 4-[[3-[3-[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-2-hydroxypropoxy]phenyl]methyl]-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN(Cc2cccc(OCC(O)CN3C[C@H]4COC[C@H]4C3)c2)CC1 |
| InChI | InChI=1S/C23H36N4O4/c1-24(2)23(29)27-8-6-25(7-9-27)11-18-4-3-5-22(10-18)31-17-21(28)14-26-12-19-15-30-16-20(19)13-26/h3-5,10,19-21,28H,6-9,11-17H2,1-2H3/t19-,20+,21? |
| InChIKey | NDEQNPXWXVWXHN-WCRBZPEASA-N |
| XLogP | 0.80 |
| TPSA | 68.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |