C18H21ClN4O2S — CID 175641897
1-(3-chloro-4-methoxyphenyl)-3-(4-pyrimidin-2-ylsulfanylcyclohexyl)urea (PubChem CID 175641897) has the molecular formula C18H21ClN4O2S and a molecular weight of 392.91 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-(4-pyrimidin-2-ylsulfanylcyclohexyl)urea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-(4-pyrimidin-2-ylsulfanylcyclohexyl)urea |
|---|---|
| PubChem CID | 175641897 |
| Molecular Formula | C18H21ClN4O2S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-(4-pyrimidin-2-ylsulfanylcyclohexyl)urea |
| SMILES | COc1ccc(NC(=O)NC2CCC(Sc3ncccn3)CC2)cc1Cl |
| InChI | InChI=1S/C18H21ClN4O2S/c1-25-16-8-5-13(11-15(16)19)23-17(24)22-12-3-6-14(7-4-12)26-18-20-9-2-10-21-18/h2,5,8-12,14H,3-4,6-7H2,1H3,(H2,22,23,24) |
| InChIKey | KXRMPUSZUWIMIN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |